C24H29N5O3S — CID 90684621
2-N-[3-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]-5-(4-ethoxyphenyl)-4-N-(oxolan-2-ylmethyl)pyrimidine-2,4-diamine (PubChem CID 90684621) has the molecular formula C24H29N5O3S and a molecular weight of 467.60 g/mol. Its IUPAC name is 2-N-[3-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]-5-(4-ethoxyphenyl)-4-N-(oxolan-2-ylmethyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[3-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]-5-(4-ethoxyphenyl)-4-N-(oxolan-2-ylmethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 90684621 |
| Molecular Formula | C24H29N5O3S |
| Molecular Weight | 467.60 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | 2-N-[3-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]-5-(4-ethoxyphenyl)-4-N-(oxolan-2-ylmethyl)pyrimidine-2,4-diamine |
| SMILES | C=S(N)(=O)c1cccc(Nc2ncc(-c3ccc(OCC)cc3)c(NCC3CCCO3)n2)c1 |
| InChI | InChI=1S/C24H29N5O3S/c1-3-31-19-11-9-17(10-12-19)22-16-27-24(29-23(22)26-15-20-7-5-13-32-20)28-18-6-4-8-21(14-18)33(2,25)30/h4,6,8-12,14,16,20H,2-3,5,7,13,15H2,1H3,(H2,25,30)(H2,26,27,28,29) |
| InChIKey | XBTJUEYSRVXZCQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.60 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|