C27H29N5O2S — CID 91224353
2-N-[3-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]-4-N-benzyl-5-(4-ethoxyphenyl)-4-N-methylpyrimidine-2,4-diamine (PubChem CID 91224353) has the molecular formula C27H29N5O2S and a molecular weight of 487.63 g/mol. Its IUPAC name is 2-N-[3-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]-4-N-benzyl-5-(4-ethoxyphenyl)-4-N-methylpyrimidine-2,4-diamine.
| Compound Name | 2-N-[3-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]-4-N-benzyl-5-(4-ethoxyphenyl)-4-N-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 91224353 |
| Molecular Formula | C27H29N5O2S |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | 2-N-[3-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]-4-N-benzyl-5-(4-ethoxyphenyl)-4-N-methylpyrimidine-2,4-diamine |
| SMILES | C=S(N)(=O)c1cccc(Nc2ncc(-c3ccc(OCC)cc3)c(N(C)Cc3ccccc3)n2)c1 |
| InChI | InChI=1S/C27H29N5O2S/c1-4-34-23-15-13-21(14-16-23)25-18-29-27(30-22-11-8-12-24(17-22)35(3,28)33)31-26(25)32(2)19-20-9-6-5-7-10-20/h5-18H,3-4,19H2,1-2H3,(H2,28,33)(H,29,30,31) |
| InChIKey | BHCIHQSGYPBTCW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|