C26H26N5O3S- — CID 89325271
CID 89325271 (PubChem CID 89325271) has the molecular formula C26H26N5O3S- and a molecular weight of 488.59 g/mol.
| Compound Name | CID 89325271 |
|---|---|
| PubChem CID | 89325271 |
| Molecular Formula | C26H26N5O3S- |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | — |
| SMILES | [H]/N=[S-](=O)/c1cccc(Nc2ncc(-c3ccc(OCC)cc3)c(NCCOc3ccccc3)n2)c1 |
| InChI | InChI=1S/C26H26N5O3S/c1-2-33-22-13-11-19(12-14-22)24-18-29-26(30-20-7-6-10-23(17-20)35(27)32)31-25(24)28-15-16-34-21-8-4-3-5-9-21/h3-14,17-18,27H,2,15-16H2,1H3,(H2,28,29,30,31)/q-1 |
| InChIKey | DYBCCQKTNASLJG-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|