C18H17FN5OS- — CID 89205025
CID 89205025 (PubChem CID 89205025) has the molecular formula C18H17FN5OS- and a molecular weight of 370.43 g/mol.
| Compound Name | CID 89205025 |
|---|---|
| PubChem CID | 89205025 |
| Molecular Formula | C18H17FN5OS- |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | — |
| SMILES | [H]/N=[S-](=O)/c1ccc(Nc2ncc(-c3ccc(F)c(C)c3)c(NC)n2)cc1 |
| InChI | InChI=1S/C18H17FN5OS/c1-11-9-12(3-8-16(11)19)15-10-22-18(24-17(15)21-2)23-13-4-6-14(7-5-13)26(20)25/h3-10,20H,1-2H3,(H2,21,22,23,24)/q-1 |
| InChIKey | DNINGOBCILNCJL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 90.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|