About CID 89219814
CID 89219814 (PubChem CID 89219814) has the molecular formula C22H27N6O4S2-
and a molecular weight of 503.63 g/mol.
Molecular Properties
| Compound Name | CID 89219814 |
| PubChem CID | 89219814 |
| Molecular Formula | C22H27N6O4S2- |
| Molecular Weight | 503.63 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | — |
| SMILES | [H]/N=[S-](=O)/c1ccc(Nc2ncc(Cc3cc(NOS(C)=O)ccc3C)c(N[C@H](C)CO)n2)cc1 |
| InChI | InChI=1S/C22H27N6O4S2/c1-14-4-5-19(28-32-33(3)30)11-16(14)10-17-12-24-22(27-21(17)25-15(2)13-29)26-18-6-8-20(9-7-18)34(23)31/h4-9,11-12,15,23,28-29H,10,13H2,1-3H3,(H2,24,25,26,27)/q-1/t15-,33?/m1/s1 |
| InChIKey | RCJIMPHVTKOPQF-FJNJALAMSA-N |
| XLogP | 3.63 |
| TPSA | 149.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 503.63 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze CID 89219814 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89219814?
The IUPAC name of CID 89219814 (CID 89219814) is not available.
What is the SMILES notation for CID 89219814?
The canonical SMILES for CID 89219814 is [H]/N=[S-](=O)/c1ccc(Nc2ncc(Cc3cc(NOS(C)=O)ccc3C)c(N[C@H](C)CO)n2)cc1.
What is the InChIKey of CID 89219814?
The InChIKey is RCJIMPHVTKOPQF-FJNJALAMSA-N. The full InChI is InChI=1S/C22H27N6O4S2/c1-14-4-5-19(28-32-33(3)30)11-16(14)10-17-12-24-22(27-21(17)25-15(2)13-29)26-18-6-8-20(9-7-18)34(23)31/h4-9,11-12,15,23,28-29H,10,13H2,1-3H3,(H2,24,25,26,27)/q-1/t15-,33?/m1/s1.
What are the key properties of CID 89219814?
CID 89219814 has a molecular weight of 503.63 g/mol, XLogP of 3.63, 11 rotatable bonds, 5 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89219814 is sourced from PubChem (CID 89219814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).