C22H27N6O4S2- — CID 89219814
CID 89219814 (PubChem CID 89219814) has the molecular formula C22H27N6O4S2- and a molecular weight of 503.63 g/mol.
| Compound Name | CID 89219814 |
|---|---|
| PubChem CID | 89219814 |
| Molecular Formula | C22H27N6O4S2- |
| Molecular Weight | 503.63 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | — |
| SMILES | [H]/N=[S-](=O)/c1ccc(Nc2ncc(Cc3cc(NOS(C)=O)ccc3C)c(N[C@H](C)CO)n2)cc1 |
| InChI | InChI=1S/C22H27N6O4S2/c1-14-4-5-19(28-32-33(3)30)11-16(14)10-17-12-24-22(27-21(17)25-15(2)13-29)26-18-6-8-20(9-7-18)34(23)31/h4-9,11-12,15,23,28-29H,10,13H2,1-3H3,(H2,24,25,26,27)/q-1/t15-,33?/m1/s1 |
| InChIKey | RCJIMPHVTKOPQF-FJNJALAMSA-N |
| XLogP | 3.63 |
| TPSA | 149.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.63 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|