C27H34N7O5S- — CID 173495554
CID 173495554 (PubChem CID 173495554) has the molecular formula C27H34N7O5S- and a molecular weight of 568.68 g/mol.
| Compound Name | CID 173495554 |
|---|---|
| PubChem CID | 173495554 |
| Molecular Formula | C27H34N7O5S- |
| Molecular Weight | 568.68 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | — |
| SMILES | CCCCNC(=O)Nc1ccc(-c2cnc(Nc3ccc(/[S-](=O)=N/C(=O)OCC)cc3)nc2N[C@H](C)CO)cc1 |
| InChI | InChI=1S/C27H34N7O5S/c1-4-6-15-28-26(36)32-21-9-7-19(8-10-21)23-16-29-25(33-24(23)30-18(3)17-35)31-20-11-13-22(14-12-20)40(38)34-27(37)39-5-2/h7-14,16,18,35H,4-6,15,17H2,1-3H3,(H2,28,32,36)(H2,29,30,31,33)/q-1/t18-/m1/s1 |
| InChIKey | SCXHPTJXFBAMKR-GOSISDBHSA-N |
| XLogP | 5.26 |
| TPSA | 166.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.68 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|