C25H26N5O4S- — CID 173489320
CID 173489320 (PubChem CID 173489320) has the molecular formula C25H26N5O4S- and a molecular weight of 492.58 g/mol.
| Compound Name | CID 173489320 |
|---|---|
| PubChem CID | 173489320 |
| Molecular Formula | C25H26N5O4S- |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | — |
| SMILES | CCOC(=O)/N=[S-](=O)/c1ccc(Nc2ncc(C#Cc3ccccc3C)c(N[C@H](C)CO)n2)cc1 |
| InChI | InChI=1S/C25H26N5O4S/c1-4-34-25(32)30-35(33)22-13-11-21(12-14-22)28-24-26-15-20(23(29-24)27-18(3)16-31)10-9-19-8-6-5-7-17(19)2/h5-8,11-15,18,31H,4,16H2,1-3H3,(H2,26,27,28,29)/q-1/t18-/m1/s1 |
| InChIKey | BARMAYKGQVUBCK-GOSISDBHSA-N |
| XLogP | 4.38 |
| TPSA | 125.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|