About CID 89293156
CID 89293156 (PubChem CID 89293156) has the molecular formula C33H32F3N6O5S-
and a molecular weight of 681.72 g/mol.
Molecular Properties
| Compound Name | CID 89293156 |
| PubChem CID | 89293156 |
| Molecular Formula | C33H32F3N6O5S- |
| Molecular Weight | 681.72 g/mol |
| Exact Mass | 681.21 |
| IUPAC Name | — |
| SMILES | CCOC(=O)/N=[S-](=O)/c1ccc(Nc2ncc(-c3ccc(NC(=O)C4(c5cccc(C(F)(F)F)c5)CC4)cc3)c(NC(C)CO)n2)cc1 |
| InChI | InChI=1S/C33H32F3N6O5S/c1-3-47-31(45)42-48(46)26-13-11-25(12-14-26)40-30-37-18-27(28(41-30)38-20(2)19-43)21-7-9-24(10-8-21)39-29(44)32(15-16-32)22-5-4-6-23(17-22)33(34,35)36/h4-14,17-18,20,43H,3,15-16,19H2,1-2H3,(H,39,44)(H2,37,38,40,41)/q-1 |
| InChIKey | CEBDDCSRLFBEJR-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 154.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 681.72 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze CID 89293156 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89293156?
The IUPAC name of CID 89293156 (CID 89293156) is not available.
What is the SMILES notation for CID 89293156?
The canonical SMILES for CID 89293156 is CCOC(=O)/N=[S-](=O)/c1ccc(Nc2ncc(-c3ccc(NC(=O)C4(c5cccc(C(F)(F)F)c5)CC4)cc3)c(NC(C)CO)n2)cc1.
What is the InChIKey of CID 89293156?
The InChIKey is CEBDDCSRLFBEJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H32F3N6O5S/c1-3-47-31(45)42-48(46)26-13-11-25(12-14-26)40-30-37-18-27(28(41-30)38-20(2)19-43)21-7-9-24(10-8-21)39-29(44)32(15-16-32)22-5-4-6-23(17-22)33(34,35)36/h4-14,17-18,20,43H,3,15-16,19H2,1-2H3,(H,39,44)(H2,37,38,40,41)/q-1.
What are the key properties of CID 89293156?
CID 89293156 has a molecular weight of 681.72 g/mol, XLogP of 7.03, 11 rotatable bonds, 4 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89293156 is sourced from PubChem (CID 89293156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).