C22H22N5O3S- — CID 89219873
CID 89219873 (PubChem CID 89219873) has the molecular formula C22H22N5O3S- and a molecular weight of 436.52 g/mol.
| Compound Name | CID 89219873 |
|---|---|
| PubChem CID | 89219873 |
| Molecular Formula | C22H22N5O3S- |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | — |
| SMILES | [H]/N=[S-](=O)/c1ccc(Nc2ncc(C#Cc3cccc(OC)c3)c(N[C@H](C)CO)n2)cc1 |
| InChI | InChI=1S/C22H22N5O3S/c1-15(14-28)25-21-17(7-6-16-4-3-5-19(12-16)30-2)13-24-22(27-21)26-18-8-10-20(11-9-18)31(23)29/h3-5,8-13,15,23,28H,14H2,1-2H3,(H2,24,25,26,27)/q-1/t15-/m1/s1 |
| InChIKey | IEDNGGQNJUECEB-OAHLLOKOSA-N |
| XLogP | 3.51 |
| TPSA | 120.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|