About CID 89219873
CID 89219873 (PubChem CID 89219873) has the molecular formula C22H22N5O3S-
and a molecular weight of 436.52 g/mol.
Molecular Properties
| Compound Name | CID 89219873 |
| PubChem CID | 89219873 |
| Molecular Formula | C22H22N5O3S- |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | — |
| SMILES | [H]/N=[S-](=O)/c1ccc(Nc2ncc(C#Cc3cccc(OC)c3)c(N[C@H](C)CO)n2)cc1 |
| InChI | InChI=1S/C22H22N5O3S/c1-15(14-28)25-21-17(7-6-16-4-3-5-19(12-16)30-2)13-24-22(27-21)26-18-8-10-20(11-9-18)31(23)29/h3-5,8-13,15,23,28H,14H2,1-2H3,(H2,24,25,26,27)/q-1/t15-/m1/s1 |
| InChIKey | IEDNGGQNJUECEB-OAHLLOKOSA-N |
| XLogP | 3.51 |
| TPSA | 120.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 89219873 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89219873?
The IUPAC name of CID 89219873 (CID 89219873) is not available.
What is the SMILES notation for CID 89219873?
The canonical SMILES for CID 89219873 is [H]/N=[S-](=O)/c1ccc(Nc2ncc(C#Cc3cccc(OC)c3)c(N[C@H](C)CO)n2)cc1.
What is the InChIKey of CID 89219873?
The InChIKey is IEDNGGQNJUECEB-OAHLLOKOSA-N. The full InChI is InChI=1S/C22H22N5O3S/c1-15(14-28)25-21-17(7-6-16-4-3-5-19(12-16)30-2)13-24-22(27-21)26-18-8-10-20(11-9-18)31(23)29/h3-5,8-13,15,23,28H,14H2,1-2H3,(H2,24,25,26,27)/q-1/t15-/m1/s1.
What are the key properties of CID 89219873?
CID 89219873 has a molecular weight of 436.52 g/mol, XLogP of 3.51, 7 rotatable bonds, 4 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89219873 is sourced from PubChem (CID 89219873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).