C23H25N5O3S — CID 91163227
(2R)-2-[[2-[3-(amino-methylidene-oxo-λ6-sulfanyl)anilino]-5-[2-(3-methoxyphenyl)ethynyl]pyrimidin-4-yl]amino]propan-1-ol (PubChem CID 91163227) has the molecular formula C23H25N5O3S and a molecular weight of 451.55 g/mol. Its IUPAC name is (2R)-2-[[2-[3-(amino-methylidene-oxo-λ6-sulfanyl)anilino]-5-[2-(3-methoxyphenyl)ethynyl]pyrimidin-4-yl]amino]propan-1-ol.
| Compound Name | (2R)-2-[[2-[3-(amino-methylidene-oxo-λ6-sulfanyl)anilino]-5-[2-(3-methoxyphenyl)ethynyl]pyrimidin-4-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 91163227 |
| Molecular Formula | C23H25N5O3S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | (2R)-2-[[2-[3-(amino-methylidene-oxo-λ6-sulfanyl)anilino]-5-[2-(3-methoxyphenyl)ethynyl]pyrimidin-4-yl]amino]propan-1-ol |
| SMILES | C=S(N)(=O)c1cccc(Nc2ncc(C#Cc3cccc(OC)c3)c(N[C@H](C)CO)n2)c1 |
| InChI | InChI=1S/C23H25N5O3S/c1-16(15-29)26-22-18(11-10-17-6-4-8-20(12-17)31-2)14-25-23(28-22)27-19-7-5-9-21(13-19)32(3,24)30/h4-9,12-14,16,29H,3,15H2,1-2H3,(H2,24,30)(H2,25,26,27,28)/t16-,32?/m1/s1 |
| InChIKey | KTCNLCBRNFNIAJ-FCBBPLNGSA-N |
| XLogP | 2.37 |
| TPSA | 122.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|