C11H10FIN4 — CID 80763314
5-fluoro-4-N-(4-iodophenyl)-2-N-methylpyrimidine-2,4-diamine (PubChem CID 80763314) has the molecular formula C11H10FIN4 and a molecular weight of 344.13 g/mol. Its IUPAC name is 5-fluoro-4-N-(4-iodophenyl)-2-N-methylpyrimidine-2,4-diamine.
| Compound Name | 5-fluoro-4-N-(4-iodophenyl)-2-N-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80763314 |
| Molecular Formula | C11H10FIN4 |
| Molecular Weight | 344.13 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | 5-fluoro-4-N-(4-iodophenyl)-2-N-methylpyrimidine-2,4-diamine |
| SMILES | CNc1ncc(F)c(Nc2ccc(I)cc2)n1 |
| InChI | InChI=1S/C11H10FIN4/c1-14-11-15-6-9(12)10(17-11)16-8-4-2-7(13)3-5-8/h2-6H,1H3,(H2,14,15,16,17) |
| InChIKey | ODPBEMDPGWYHTQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.13 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|