C16H11F3N4 — CID 954308
5-fluoro-2-N,4-N-bis(4-fluorophenyl)pyrimidine-2,4-diamine (PubChem CID 954308) has the molecular formula C16H11F3N4 and a molecular weight of 316.29 g/mol. Its IUPAC name is 5-fluoro-2-N,4-N-bis(4-fluorophenyl)pyrimidine-2,4-diamine.
| Compound Name | 5-fluoro-2-N,4-N-bis(4-fluorophenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 954308 |
| Molecular Formula | C16H11F3N4 |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 5-fluoro-2-N,4-N-bis(4-fluorophenyl)pyrimidine-2,4-diamine |
| SMILES | Fc1ccc(Nc2ncc(F)c(Nc3ccc(F)cc3)n2)cc1 |
| InChI | InChI=1S/C16H11F3N4/c17-10-1-5-12(6-2-10)21-15-14(19)9-20-16(23-15)22-13-7-3-11(18)4-8-13/h1-9H,(H2,20,21,22,23) |
| InChIKey | BTKZQEGTHZXVJD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |