C21H25ClN6 — CID 24990525
N'-[4-[2-(3-chloroanilino)pyrimidin-4-yl]-3-methyl-2-pyridinyl]-N,N'-dimethylpropane-1,3-diamine (PubChem CID 24990525) has the molecular formula C21H25ClN6 and a molecular weight of 396.93 g/mol. Its IUPAC name is N'-[4-[2-(3-chloroanilino)pyrimidin-4-yl]-3-methyl-2-pyridinyl]-N,N'-dimethylpropane-1,3-diamine.
| Compound Name | N'-[4-[2-(3-chloroanilino)pyrimidin-4-yl]-3-methyl-2-pyridinyl]-N,N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 24990525 |
| Molecular Formula | C21H25ClN6 |
| Molecular Weight | 396.93 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | N'-[4-[2-(3-chloroanilino)pyrimidin-4-yl]-3-methyl-2-pyridinyl]-N,N'-dimethylpropane-1,3-diamine |
| SMILES | CNCCCN(C)c1nccc(-c2ccnc(Nc3cccc(Cl)c3)n2)c1C |
| InChI | InChI=1S/C21H25ClN6/c1-15-18(8-11-24-20(15)28(3)13-5-10-23-2)19-9-12-25-21(27-19)26-17-7-4-6-16(22)14-17/h4,6-9,11-12,14,23H,5,10,13H2,1-3H3,(H,25,26,27) |
| InChIKey | PAXCQARVEJNBBF-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.93 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|