C21H24ClN7O — CID 59200669
N-[3-[[4-[2-(3-chloroanilino)pyrimidin-4-yl]-2-(methylamino)-3-pyridinyl]amino]propyl]acetamide (PubChem CID 59200669) has the molecular formula C21H24ClN7O and a molecular weight of 425.92 g/mol. Its IUPAC name is N-[3-[[4-[2-(3-chloroanilino)pyrimidin-4-yl]-2-(methylamino)-3-pyridinyl]amino]propyl]acetamide.
| Compound Name | N-[3-[[4-[2-(3-chloroanilino)pyrimidin-4-yl]-2-(methylamino)-3-pyridinyl]amino]propyl]acetamide |
|---|---|
| PubChem CID | 59200669 |
| Molecular Formula | C21H24ClN7O |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | N-[3-[[4-[2-(3-chloroanilino)pyrimidin-4-yl]-2-(methylamino)-3-pyridinyl]amino]propyl]acetamide |
| SMILES | CNc1nccc(-c2ccnc(Nc3cccc(Cl)c3)n2)c1NCCCNC(C)=O |
| InChI | InChI=1S/C21H24ClN7O/c1-14(30)24-9-4-10-25-19-17(7-11-26-20(19)23-2)18-8-12-27-21(29-18)28-16-6-3-5-15(22)13-16/h3,5-8,11-13,25H,4,9-10H2,1-2H3,(H,23,26)(H,24,30)(H,27,28,29) |
| InChIKey | OYKGKLINYJNVJQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|