C19H20ClN7O — CID 59200672
N-[3-[[3-[4-(3-chloroanilino)-1,3,5-triazin-2-yl]-2-pyridinyl]amino]propyl]acetamide (PubChem CID 59200672) has the molecular formula C19H20ClN7O and a molecular weight of 397.87 g/mol. Its IUPAC name is N-[3-[[3-[4-(3-chloroanilino)-1,3,5-triazin-2-yl]-2-pyridinyl]amino]propyl]acetamide.
| Compound Name | N-[3-[[3-[4-(3-chloroanilino)-1,3,5-triazin-2-yl]-2-pyridinyl]amino]propyl]acetamide |
|---|---|
| PubChem CID | 59200672 |
| Molecular Formula | C19H20ClN7O |
| Molecular Weight | 397.87 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | N-[3-[[3-[4-(3-chloroanilino)-1,3,5-triazin-2-yl]-2-pyridinyl]amino]propyl]acetamide |
| SMILES | CC(=O)NCCCNc1ncccc1-c1ncnc(Nc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C19H20ClN7O/c1-13(28)21-9-4-10-23-17-16(7-3-8-22-17)18-24-12-25-19(27-18)26-15-6-2-5-14(20)11-15/h2-3,5-8,11-12H,4,9-10H2,1H3,(H,21,28)(H,22,23)(H,24,25,26,27) |
| InChIKey | BEKGNVNRBWCCHD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 104.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.87 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|