C20H23F4N5O3 — CID 68623449
N-[3-[[5-cyclopropyl-2-(3-fluoroanilino)pyrimidin-4-yl]amino]propyl]acetamide;2,2,2-trifluoroacetic acid (PubChem CID 68623449) has the molecular formula C20H23F4N5O3 and a molecular weight of 457.43 g/mol. Its IUPAC name is N-[3-[[5-cyclopropyl-2-(3-fluoroanilino)pyrimidin-4-yl]amino]propyl]acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[3-[[5-cyclopropyl-2-(3-fluoroanilino)pyrimidin-4-yl]amino]propyl]acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68623449 |
| Molecular Formula | C20H23F4N5O3 |
| Molecular Weight | 457.43 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | N-[3-[[5-cyclopropyl-2-(3-fluoroanilino)pyrimidin-4-yl]amino]propyl]acetamide;2,2,2-trifluoroacetic acid |
| SMILES | CC(=O)NCCCNc1nc(Nc2cccc(F)c2)ncc1C1CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H22FN5O.C2HF3O2/c1-12(25)20-8-3-9-21-17-16(13-6-7-13)11-22-18(24-17)23-15-5-2-4-14(19)10-15;3-2(4,5)1(6)7/h2,4-5,10-11,13H,3,6-9H2,1H3,(H,20,25)(H2,21,22,23,24);(H,6,7) |
| InChIKey | YZLRWWIGNDYPBT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 116.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|