C26H30N6O — CID 59225381
N-[3-[[5-cyclopropyl-2-(3-pyridin-4-ylanilino)pyrimidin-4-yl]amino]propyl]cyclobutanecarboxamide (PubChem CID 59225381) has the molecular formula C26H30N6O and a molecular weight of 442.57 g/mol. Its IUPAC name is N-[3-[[5-cyclopropyl-2-(3-pyridin-4-ylanilino)pyrimidin-4-yl]amino]propyl]cyclobutanecarboxamide.
| Compound Name | N-[3-[[5-cyclopropyl-2-(3-pyridin-4-ylanilino)pyrimidin-4-yl]amino]propyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 59225381 |
| Molecular Formula | C26H30N6O |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | N-[3-[[5-cyclopropyl-2-(3-pyridin-4-ylanilino)pyrimidin-4-yl]amino]propyl]cyclobutanecarboxamide |
| SMILES | O=C(NCCCNc1nc(Nc2cccc(-c3ccncc3)c2)ncc1C1CC1)C1CCC1 |
| InChI | InChI=1S/C26H30N6O/c33-25(20-4-1-5-20)29-13-3-12-28-24-23(19-8-9-19)17-30-26(32-24)31-22-7-2-6-21(16-22)18-10-14-27-15-11-18/h2,6-7,10-11,14-17,19-20H,1,3-5,8-9,12-13H2,(H,29,33)(H2,28,30,31,32) |
| InChIKey | PQBYWULYHIRFMB-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|