C21H28FN5O — CID 59225307
N-[3-[[2-(3-fluoroanilino)-5-propan-2-ylpyrimidin-4-yl]amino]propyl]cyclobutanecarboxamide (PubChem CID 59225307) has the molecular formula C21H28FN5O and a molecular weight of 385.49 g/mol. Its IUPAC name is N-[3-[[2-(3-fluoroanilino)-5-propan-2-ylpyrimidin-4-yl]amino]propyl]cyclobutanecarboxamide.
| Compound Name | N-[3-[[2-(3-fluoroanilino)-5-propan-2-ylpyrimidin-4-yl]amino]propyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 59225307 |
| Molecular Formula | C21H28FN5O |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | N-[3-[[2-(3-fluoroanilino)-5-propan-2-ylpyrimidin-4-yl]amino]propyl]cyclobutanecarboxamide |
| SMILES | CC(C)c1cnc(Nc2cccc(F)c2)nc1NCCCNC(=O)C1CCC1 |
| InChI | InChI=1S/C21H28FN5O/c1-14(2)18-13-25-21(26-17-9-4-8-16(22)12-17)27-19(18)23-10-5-11-24-20(28)15-6-3-7-15/h4,8-9,12-15H,3,5-7,10-11H2,1-2H3,(H,24,28)(H2,23,25,26,27) |
| InChIKey | IWBSHHKFHATOAP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|