C23H23F4N5O4 — CID 68622167
N-[3-[[5-cyclopropyl-2-(3-fluoroanilino)pyrimidin-4-yl]amino]propyl]furan-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 68622167) has the molecular formula C23H23F4N5O4 and a molecular weight of 509.46 g/mol. Its IUPAC name is N-[3-[[5-cyclopropyl-2-(3-fluoroanilino)pyrimidin-4-yl]amino]propyl]furan-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[3-[[5-cyclopropyl-2-(3-fluoroanilino)pyrimidin-4-yl]amino]propyl]furan-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68622167 |
| Molecular Formula | C23H23F4N5O4 |
| Molecular Weight | 509.46 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | N-[3-[[5-cyclopropyl-2-(3-fluoroanilino)pyrimidin-4-yl]amino]propyl]furan-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NCCCNc1nc(Nc2cccc(F)c2)ncc1C1CC1)c1ccco1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H22FN5O2.C2HF3O2/c22-15-4-1-5-16(12-15)26-21-25-13-17(14-7-8-14)19(27-21)23-9-3-10-24-20(28)18-6-2-11-29-18;3-2(4,5)1(6)7/h1-2,4-6,11-14H,3,7-10H2,(H,24,28)(H2,23,25,26,27);(H,6,7) |
| InChIKey | HOUXBAIUEKVQBT-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 129.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|