C18H22N6 — CID 68622170
2-[3-[[4-(3-aminopropylamino)-5-cyclopropylpyrimidin-2-yl]amino]phenyl]acetonitrile (PubChem CID 68622170) has the molecular formula C18H22N6 and a molecular weight of 322.42 g/mol. Its IUPAC name is 2-[3-[[4-(3-aminopropylamino)-5-cyclopropylpyrimidin-2-yl]amino]phenyl]acetonitrile.
| Compound Name | 2-[3-[[4-(3-aminopropylamino)-5-cyclopropylpyrimidin-2-yl]amino]phenyl]acetonitrile |
|---|---|
| PubChem CID | 68622170 |
| Molecular Formula | C18H22N6 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 2-[3-[[4-(3-aminopropylamino)-5-cyclopropylpyrimidin-2-yl]amino]phenyl]acetonitrile |
| SMILES | N#CCc1cccc(Nc2ncc(C3CC3)c(NCCCN)n2)c1 |
| InChI | InChI=1S/C18H22N6/c19-8-2-10-21-17-16(14-5-6-14)12-22-18(24-17)23-15-4-1-3-13(11-15)7-9-20/h1,3-4,11-12,14H,2,5-8,10,19H2,(H2,21,22,23,24) |
| InChIKey | RNCLDGGDXPUCGO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|