C17H21ClFN5 — CID 89092411
4-N-[3-[chloro(methyl)amino]propyl]-5-cyclopropyl-2-N-(3-fluorophenyl)pyrimidine-2,4-diamine (PubChem CID 89092411) has the molecular formula C17H21ClFN5 and a molecular weight of 349.84 g/mol. Its IUPAC name is 4-N-[3-[chloro(methyl)amino]propyl]-5-cyclopropyl-2-N-(3-fluorophenyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-[3-[chloro(methyl)amino]propyl]-5-cyclopropyl-2-N-(3-fluorophenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 89092411 |
| Molecular Formula | C17H21ClFN5 |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 4-N-[3-[chloro(methyl)amino]propyl]-5-cyclopropyl-2-N-(3-fluorophenyl)pyrimidine-2,4-diamine |
| SMILES | CN(Cl)CCCNc1nc(Nc2cccc(F)c2)ncc1C1CC1 |
| InChI | InChI=1S/C17H21ClFN5/c1-24(18)9-3-8-20-16-15(12-6-7-12)11-21-17(23-16)22-14-5-2-4-13(19)10-14/h2,4-5,10-12H,3,6-9H2,1H3,(H2,20,21,22,23) |
| InChIKey | WFTHYUDFBSWUAZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|