C14H14ClFN4O — CID 90052201
2-(3-fluoroanilino)-4-(propylamino)pyrimidine-5-carbonyl chloride (PubChem CID 90052201) has the molecular formula C14H14ClFN4O and a molecular weight of 308.74 g/mol. Its IUPAC name is 2-(3-fluoroanilino)-4-(propylamino)pyrimidine-5-carbonyl chloride.
| Compound Name | 2-(3-fluoroanilino)-4-(propylamino)pyrimidine-5-carbonyl chloride |
|---|---|
| PubChem CID | 90052201 |
| Molecular Formula | C14H14ClFN4O |
| Molecular Weight | 308.74 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 2-(3-fluoroanilino)-4-(propylamino)pyrimidine-5-carbonyl chloride |
| SMILES | CCCNc1nc(Nc2cccc(F)c2)ncc1C(=O)Cl |
| InChI | InChI=1S/C14H14ClFN4O/c1-2-6-17-13-11(12(15)21)8-18-14(20-13)19-10-5-3-4-9(16)7-10/h3-5,7-8H,2,6H2,1H3,(H2,17,18,19,20) |
| InChIKey | FBHAGRXFYAVHSO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.74 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|