C21H22FN5 — CID 123393726
5-[2-(3-aminophenyl)ethenyl]-2-N-(3-fluorophenyl)-4-N-propylpyrimidine-2,4-diamine (PubChem CID 123393726) has the molecular formula C21H22FN5 and a molecular weight of 363.44 g/mol. Its IUPAC name is 5-[2-(3-aminophenyl)ethenyl]-2-N-(3-fluorophenyl)-4-N-propylpyrimidine-2,4-diamine.
| Compound Name | 5-[2-(3-aminophenyl)ethenyl]-2-N-(3-fluorophenyl)-4-N-propylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 123393726 |
| Molecular Formula | C21H22FN5 |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 5-[2-(3-aminophenyl)ethenyl]-2-N-(3-fluorophenyl)-4-N-propylpyrimidine-2,4-diamine |
| SMILES | CCCNc1nc(Nc2cccc(F)c2)ncc1C=Cc1cccc(N)c1 |
| InChI | InChI=1S/C21H22FN5/c1-2-11-24-20-16(10-9-15-5-3-7-18(23)12-15)14-25-21(27-20)26-19-8-4-6-17(22)13-19/h3-10,12-14H,2,11,23H2,1H3,(H2,24,25,26,27) |
| InChIKey | YBGKLUHICKNWEY-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|