C25H31FN4O4 — CID 90052124
diethyl 2-[4-[2-(3-fluoroanilino)-4-(propylamino)pyrimidin-5-yl]-2-methylbut-3-yn-2-yl]propanedioate (PubChem CID 90052124) has the molecular formula C25H31FN4O4 and a molecular weight of 470.55 g/mol. Its IUPAC name is diethyl 2-[4-[2-(3-fluoroanilino)-4-(propylamino)pyrimidin-5-yl]-2-methylbut-3-yn-2-yl]propanedioate.
| Compound Name | diethyl 2-[4-[2-(3-fluoroanilino)-4-(propylamino)pyrimidin-5-yl]-2-methylbut-3-yn-2-yl]propanedioate |
|---|---|
| PubChem CID | 90052124 |
| Molecular Formula | C25H31FN4O4 |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | diethyl 2-[4-[2-(3-fluoroanilino)-4-(propylamino)pyrimidin-5-yl]-2-methylbut-3-yn-2-yl]propanedioate |
| SMILES | CCCNc1nc(Nc2cccc(F)c2)ncc1C#CC(C)(C)C(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C25H31FN4O4/c1-6-14-27-21-17(16-28-24(30-21)29-19-11-9-10-18(26)15-19)12-13-25(4,5)20(22(31)33-7-2)23(32)34-8-3/h9-11,15-16,20H,6-8,14H2,1-5H3,(H2,27,28,29,30) |
| InChIKey | GRNSGYIBBBQKHW-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|