C18H21F2N5 — CID 90052649
5-(5-aminopent-1-ynyl)-2-N-(3-fluorophenyl)-4-N-(3-fluoropropyl)pyrimidine-2,4-diamine (PubChem CID 90052649) has the molecular formula C18H21F2N5 and a molecular weight of 345.40 g/mol. Its IUPAC name is 5-(5-aminopent-1-ynyl)-2-N-(3-fluorophenyl)-4-N-(3-fluoropropyl)pyrimidine-2,4-diamine.
| Compound Name | 5-(5-aminopent-1-ynyl)-2-N-(3-fluorophenyl)-4-N-(3-fluoropropyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 90052649 |
| Molecular Formula | C18H21F2N5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 5-(5-aminopent-1-ynyl)-2-N-(3-fluorophenyl)-4-N-(3-fluoropropyl)pyrimidine-2,4-diamine |
| SMILES | NCCCC#Cc1cnc(Nc2cccc(F)c2)nc1NCCCF |
| InChI | InChI=1S/C18H21F2N5/c19-9-5-11-22-17-14(6-2-1-3-10-21)13-23-18(25-17)24-16-8-4-7-15(20)12-16/h4,7-8,12-13H,1,3,5,9-11,21H2,(H2,22,23,24,25) |
| InChIKey | YANQRTOYFQZDHT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|