C28H40FN7O2 — CID 156766422
(E)-4-(dimethylamino)-N-[(1S,2S)-1-[5-[2-(3-fluoroanilino)-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-hydroxypropan-2-yl]-N-methylbut-2-enamide (PubChem CID 156766422) has the molecular formula C28H40FN7O2 and a molecular weight of 525.67 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-N-[(1S,2S)-1-[5-[2-(3-fluoroanilino)-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-hydroxypropan-2-yl]-N-methylbut-2-enamide.
| Compound Name | (E)-4-(dimethylamino)-N-[(1S,2S)-1-[5-[2-(3-fluoroanilino)-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-hydroxypropan-2-yl]-N-methylbut-2-enamide |
|---|---|
| PubChem CID | 156766422 |
| Molecular Formula | C28H40FN7O2 |
| Molecular Weight | 525.67 g/mol |
| Exact Mass | 525.32 |
| IUPAC Name | (E)-4-(dimethylamino)-N-[(1S,2S)-1-[5-[2-(3-fluoroanilino)-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-hydroxypropan-2-yl]-N-methylbut-2-enamide |
| SMILES | CCCNc1nc(Nc2cccc(F)c2)ncc1C#CCCCN[C@@H](O)[C@H](C)N(C)C(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C28H40FN7O2/c1-6-16-30-26-22(20-32-28(34-26)33-24-14-10-13-23(29)19-24)12-8-7-9-17-31-27(38)21(2)36(5)25(37)15-11-18-35(3)4/h10-11,13-15,19-21,27,31,38H,6-7,9,16-18H2,1-5H3,(H2,30,32,33,34)/b15-11+/t21-,27-/m0/s1 |
| InChIKey | ZXKATIJQKMJWLE-IQKVCBNYSA-N |
| XLogP | 3.19 |
| TPSA | 105.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.67 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|