C29H41N7O3 — CID 90053178
(E)-4-(dimethylamino)-N-[(2S)-1-[5-[4-(4-methoxyanilino)-2-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-N-methylbut-2-enamide (PubChem CID 90053178) has the molecular formula C29H41N7O3 and a molecular weight of 535.69 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-N-[(2S)-1-[5-[4-(4-methoxyanilino)-2-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-N-methylbut-2-enamide.
| Compound Name | (E)-4-(dimethylamino)-N-[(2S)-1-[5-[4-(4-methoxyanilino)-2-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-N-methylbut-2-enamide |
|---|---|
| PubChem CID | 90053178 |
| Molecular Formula | C29H41N7O3 |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.33 |
| IUPAC Name | (E)-4-(dimethylamino)-N-[(2S)-1-[5-[4-(4-methoxyanilino)-2-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-N-methylbut-2-enamide |
| SMILES | CCCNc1ncc(C#CCCCNC(=O)[C@H](C)N(C)C(=O)/C=C/CN(C)C)c(Nc2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C29H41N7O3/c1-7-18-31-29-32-21-23(27(34-29)33-24-14-16-25(39-6)17-15-24)12-9-8-10-19-30-28(38)22(2)36(5)26(37)13-11-20-35(3)4/h11,13-17,21-22H,7-8,10,18-20H2,1-6H3,(H,30,38)(H2,31,32,33,34)/b13-11+/t22-/m0/s1 |
| InChIKey | KSNCDXFTPDCWAD-SDNYCIMKSA-N |
| XLogP | 3.26 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|