C30H40N8O — CID 122500035
(2S)-N-[5-[2-(4-cyanoanilino)-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]-2-[[(3E)-5-(dimethylamino)penta-1,3-dien-2-yl]-methylamino]propanamide (PubChem CID 122500035) has the molecular formula C30H40N8O and a molecular weight of 528.71 g/mol. Its IUPAC name is (2S)-N-[5-[2-(4-cyanoanilino)-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]-2-[[(3E)-5-(dimethylamino)penta-1,3-dien-2-yl]-methylamino]propanamide.
| Compound Name | (2S)-N-[5-[2-(4-cyanoanilino)-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]-2-[[(3E)-5-(dimethylamino)penta-1,3-dien-2-yl]-methylamino]propanamide |
|---|---|
| PubChem CID | 122500035 |
| Molecular Formula | C30H40N8O |
| Molecular Weight | 528.71 g/mol |
| Exact Mass | 528.33 |
| IUPAC Name | (2S)-N-[5-[2-(4-cyanoanilino)-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]-2-[[(3E)-5-(dimethylamino)penta-1,3-dien-2-yl]-methylamino]propanamide |
| SMILES | C=C(/C=C/CN(C)C)N(C)[C@@H](C)C(=O)NCCCC#Cc1cnc(Nc2ccc(C#N)cc2)nc1NCCC |
| InChI | InChI=1S/C30H40N8O/c1-7-18-32-28-26(22-34-30(36-28)35-27-16-14-25(21-31)15-17-27)13-9-8-10-19-33-29(39)24(3)38(6)23(2)12-11-20-37(4)5/h11-12,14-17,22,24H,2,7-8,10,18-20H2,1,3-6H3,(H,33,39)(H2,32,34,35,36)/b12-11+/t24-/m0/s1 |
| InChIKey | NILWHBBPNXSZBY-LCJITAHGSA-N |
| XLogP | 4.11 |
| TPSA | 109.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.71 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|