C30H40N8O2 — CID 90052360
(E)-N-[2-[5-[2-(4-cyanoanilino)-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-2-oxoethyl]-4-(dimethylamino)-N-propylbut-2-enamide (PubChem CID 90052360) has the molecular formula C30H40N8O2 and a molecular weight of 544.70 g/mol. Its IUPAC name is (E)-N-[2-[5-[2-(4-cyanoanilino)-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-2-oxoethyl]-4-(dimethylamino)-N-propylbut-2-enamide.
| Compound Name | (E)-N-[2-[5-[2-(4-cyanoanilino)-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-2-oxoethyl]-4-(dimethylamino)-N-propylbut-2-enamide |
|---|---|
| PubChem CID | 90052360 |
| Molecular Formula | C30H40N8O2 |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.33 |
| IUPAC Name | (E)-N-[2-[5-[2-(4-cyanoanilino)-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-2-oxoethyl]-4-(dimethylamino)-N-propylbut-2-enamide |
| SMILES | CCCNc1nc(Nc2ccc(C#N)cc2)ncc1C#CCCCNC(=O)CN(CCC)C(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C30H40N8O2/c1-5-17-33-29-25(22-34-30(36-29)35-26-15-13-24(21-31)14-16-26)11-8-7-9-18-32-27(39)23-38(19-6-2)28(40)12-10-20-37(3)4/h10,12-16,22H,5-7,9,17-20,23H2,1-4H3,(H,32,39)(H2,33,34,35,36)/b12-10+ |
| InChIKey | ZOZMIRIPGVIJEM-ZRDIBKRKSA-N |
| XLogP | 3.52 |
| TPSA | 126.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|