C30H40N10O2 — CID 123661932
4-(dimethylamino)-N-methyl-N-[2-oxo-2-[5-[4-(propylamino)-2-[4-(triazol-1-ylmethyl)anilino]pyrimidin-5-yl]pent-4-ynylamino]ethyl]but-2-enamide (PubChem CID 123661932) has the molecular formula C30H40N10O2 and a molecular weight of 572.72 g/mol. Its IUPAC name is 4-(dimethylamino)-N-methyl-N-[2-oxo-2-[5-[4-(propylamino)-2-[4-(triazol-1-ylmethyl)anilino]pyrimidin-5-yl]pent-4-ynylamino]ethyl]but-2-enamide.
| Compound Name | 4-(dimethylamino)-N-methyl-N-[2-oxo-2-[5-[4-(propylamino)-2-[4-(triazol-1-ylmethyl)anilino]pyrimidin-5-yl]pent-4-ynylamino]ethyl]but-2-enamide |
|---|---|
| PubChem CID | 123661932 |
| Molecular Formula | C30H40N10O2 |
| Molecular Weight | 572.72 g/mol |
| Exact Mass | 572.33 |
| IUPAC Name | 4-(dimethylamino)-N-methyl-N-[2-oxo-2-[5-[4-(propylamino)-2-[4-(triazol-1-ylmethyl)anilino]pyrimidin-5-yl]pent-4-ynylamino]ethyl]but-2-enamide |
| SMILES | CCCNc1nc(Nc2ccc(Cn3ccnn3)cc2)ncc1C#CCCCNC(=O)CN(C)C(=O)C=CCN(C)C |
| InChI | InChI=1S/C30H40N10O2/c1-5-16-32-29-25(10-7-6-8-17-31-27(41)23-39(4)28(42)11-9-19-38(2)3)21-33-30(36-29)35-26-14-12-24(13-15-26)22-40-20-18-34-37-40/h9,11-15,18,20-21H,5-6,8,16-17,19,22-23H2,1-4H3,(H,31,41)(H2,32,33,35,36) |
| InChIKey | YGVNTWVTQMWERC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 133.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.72 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|