C30H43N7O2 — CID 149328945
4-[[5-[5-[[(E)-8-(dimethylamino)-2-methyl-5-oxooct-6-en-2-yl]amino]pent-1-ynyl]-4-(propylamino)pyrimidin-2-yl]amino]benzamide (PubChem CID 149328945) has the molecular formula C30H43N7O2 and a molecular weight of 533.72 g/mol. Its IUPAC name is 4-[[5-[5-[[(E)-8-(dimethylamino)-2-methyl-5-oxooct-6-en-2-yl]amino]pent-1-ynyl]-4-(propylamino)pyrimidin-2-yl]amino]benzamide.
| Compound Name | 4-[[5-[5-[[(E)-8-(dimethylamino)-2-methyl-5-oxooct-6-en-2-yl]amino]pent-1-ynyl]-4-(propylamino)pyrimidin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 149328945 |
| Molecular Formula | C30H43N7O2 |
| Molecular Weight | 533.72 g/mol |
| Exact Mass | 533.35 |
| IUPAC Name | 4-[[5-[5-[[(E)-8-(dimethylamino)-2-methyl-5-oxooct-6-en-2-yl]amino]pent-1-ynyl]-4-(propylamino)pyrimidin-2-yl]amino]benzamide |
| SMILES | CCCNc1nc(Nc2ccc(C(N)=O)cc2)ncc1C#CCCCNC(C)(C)CCC(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C30H43N7O2/c1-6-19-32-28-24(22-33-29(36-28)35-25-15-13-23(14-16-25)27(31)39)11-8-7-9-20-34-30(2,3)18-17-26(38)12-10-21-37(4)5/h10,12-16,22,34H,6-7,9,17-21H2,1-5H3,(H2,31,39)(H2,32,33,35,36)/b12-10+ |
| InChIKey | YBYAZRZXXFYUGJ-ZRDIBKRKSA-N |
| XLogP | 4.11 |
| TPSA | 125.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.72 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|