C21H27N7O2 — CID 90052269
4-[[5-[5-[(2-aminoacetyl)amino]pent-1-ynyl]-4-(propylamino)pyrimidin-2-yl]amino]benzamide (PubChem CID 90052269) has the molecular formula C21H27N7O2 and a molecular weight of 409.49 g/mol. Its IUPAC name is 4-[[5-[5-[(2-aminoacetyl)amino]pent-1-ynyl]-4-(propylamino)pyrimidin-2-yl]amino]benzamide.
| Compound Name | 4-[[5-[5-[(2-aminoacetyl)amino]pent-1-ynyl]-4-(propylamino)pyrimidin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 90052269 |
| Molecular Formula | C21H27N7O2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | 4-[[5-[5-[(2-aminoacetyl)amino]pent-1-ynyl]-4-(propylamino)pyrimidin-2-yl]amino]benzamide |
| SMILES | CCCNc1nc(Nc2ccc(C(N)=O)cc2)ncc1C#CCCCNC(=O)CN |
| InChI | InChI=1S/C21H27N7O2/c1-2-11-25-20-16(6-4-3-5-12-24-18(29)13-22)14-26-21(28-20)27-17-9-7-15(8-10-17)19(23)30/h7-10,14H,2-3,5,11-13,22H2,1H3,(H2,23,30)(H,24,29)(H2,25,26,27,28) |
| InChIKey | PCZCTRNROJRQAG-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 148.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|