C24H29N7O — CID 90053411
N-[5-[2-(4-cyanoanilino)-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]pyrrolidine-2-carboxamide (PubChem CID 90053411) has the molecular formula C24H29N7O and a molecular weight of 431.54 g/mol. Its IUPAC name is N-[5-[2-(4-cyanoanilino)-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[5-[2-(4-cyanoanilino)-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 90053411 |
| Molecular Formula | C24H29N7O |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | N-[5-[2-(4-cyanoanilino)-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]pyrrolidine-2-carboxamide |
| SMILES | CCCNc1nc(Nc2ccc(C#N)cc2)ncc1C#CCCCNC(=O)C1CCCN1 |
| InChI | InChI=1S/C24H29N7O/c1-2-13-27-22-19(7-4-3-5-14-28-23(32)21-8-6-15-26-21)17-29-24(31-22)30-20-11-9-18(16-25)10-12-20/h9-12,17,21,26H,2-3,5-6,8,13-15H2,1H3,(H,28,32)(H2,27,29,30,31) |
| InChIKey | IRWYERFNYXYIQQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|