C21H29N7O2 — CID 163546706
N-[5-[2-[(3-methyl-1,2-oxazol-5-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]pyrrolidine-2-carboxamide (PubChem CID 163546706) has the molecular formula C21H29N7O2 and a molecular weight of 411.51 g/mol. Its IUPAC name is N-[5-[2-[(3-methyl-1,2-oxazol-5-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[5-[2-[(3-methyl-1,2-oxazol-5-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 163546706 |
| Molecular Formula | C21H29N7O2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | N-[5-[2-[(3-methyl-1,2-oxazol-5-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]pyrrolidine-2-carboxamide |
| SMILES | CCCNc1nc(Nc2cc(C)no2)ncc1C#CCCCNC(=O)C1CCCN1 |
| InChI | InChI=1S/C21H29N7O2/c1-3-10-23-19-16(14-25-21(27-19)26-18-13-15(2)28-30-18)8-5-4-6-11-24-20(29)17-9-7-12-22-17/h13-14,17,22H,3-4,6-7,9-12H2,1-2H3,(H,24,29)(H2,23,25,26,27) |
| InChIKey | FFPYKYOOFLHDRK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|