C18H23BrN6O — CID 173212562
(2S)-N-[3-[[5-bromo-4-(propylamino)pyrimidin-2-yl]amino]phenyl]pyrrolidine-2-carboxamide (PubChem CID 173212562) has the molecular formula C18H23BrN6O and a molecular weight of 419.33 g/mol. Its IUPAC name is (2S)-N-[3-[[5-bromo-4-(propylamino)pyrimidin-2-yl]amino]phenyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[3-[[5-bromo-4-(propylamino)pyrimidin-2-yl]amino]phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 173212562 |
| Molecular Formula | C18H23BrN6O |
| Molecular Weight | 419.33 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | (2S)-N-[3-[[5-bromo-4-(propylamino)pyrimidin-2-yl]amino]phenyl]pyrrolidine-2-carboxamide |
| SMILES | CCCNc1nc(Nc2cccc(NC(=O)[C@@H]3CCCN3)c2)ncc1Br |
| InChI | InChI=1S/C18H23BrN6O/c1-2-8-21-16-14(19)11-22-18(25-16)24-13-6-3-5-12(10-13)23-17(26)15-7-4-9-20-15/h3,5-6,10-11,15,20H,2,4,7-9H2,1H3,(H,23,26)(H2,21,22,24,25)/t15-/m0/s1 |
| InChIKey | ANHQHNFBYRBSOD-HNNXBMFYSA-N |
| XLogP | 3.50 |
| TPSA | 90.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |