C29H40N8O3 — CID 90052837
(2S)-1-[(E)-4-(dimethylamino)but-2-enoyl]-N-[5-[2-[(2-methoxy-4-pyridinyl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]pyrrolidine-2-carboxamide (PubChem CID 90052837) has the molecular formula C29H40N8O3 and a molecular weight of 548.69 g/mol. Its IUPAC name is (2S)-1-[(E)-4-(dimethylamino)but-2-enoyl]-N-[5-[2-[(2-methoxy-4-pyridinyl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(E)-4-(dimethylamino)but-2-enoyl]-N-[5-[2-[(2-methoxy-4-pyridinyl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 90052837 |
| Molecular Formula | C29H40N8O3 |
| Molecular Weight | 548.69 g/mol |
| Exact Mass | 548.32 |
| IUPAC Name | (2S)-1-[(E)-4-(dimethylamino)but-2-enoyl]-N-[5-[2-[(2-methoxy-4-pyridinyl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]pyrrolidine-2-carboxamide |
| SMILES | CCCNc1nc(Nc2ccnc(OC)c2)ncc1C#CCCCNC(=O)[C@@H]1CCCN1C(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C29H40N8O3/c1-5-15-31-27-22(21-33-29(35-27)34-23-14-17-30-25(20-23)40-4)11-7-6-8-16-32-28(39)24-12-9-19-37(24)26(38)13-10-18-36(2)3/h10,13-14,17,20-21,24H,5-6,8-9,12,15-16,18-19H2,1-4H3,(H,32,39)(H2,30,31,33,34,35)/b13-10+/t24-/m0/s1 |
| InChIKey | KLAHPWVJSOBXLX-MURVUTHMSA-N |
| XLogP | 2.80 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.69 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|