C30H42N8O5 — CID 123618715
(2S,4S)-1-[4-(dimethylamino)but-2-enoyl]-4-hydroxy-N-[5-[4-(3-methoxypropylamino)-2-[(2-methoxy-4-pyridinyl)amino]pyrimidin-5-yl]pent-4-ynyl]pyrrolidine-2-carboxamide (PubChem CID 123618715) has the molecular formula C30H42N8O5 and a molecular weight of 594.72 g/mol. Its IUPAC name is (2S,4S)-1-[4-(dimethylamino)but-2-enoyl]-4-hydroxy-N-[5-[4-(3-methoxypropylamino)-2-[(2-methoxy-4-pyridinyl)amino]pyrimidin-5-yl]pent-4-ynyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-1-[4-(dimethylamino)but-2-enoyl]-4-hydroxy-N-[5-[4-(3-methoxypropylamino)-2-[(2-methoxy-4-pyridinyl)amino]pyrimidin-5-yl]pent-4-ynyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 123618715 |
| Molecular Formula | C30H42N8O5 |
| Molecular Weight | 594.72 g/mol |
| Exact Mass | 594.33 |
| IUPAC Name | (2S,4S)-1-[4-(dimethylamino)but-2-enoyl]-4-hydroxy-N-[5-[4-(3-methoxypropylamino)-2-[(2-methoxy-4-pyridinyl)amino]pyrimidin-5-yl]pent-4-ynyl]pyrrolidine-2-carboxamide |
| SMILES | COCCCNc1nc(Nc2ccnc(OC)c2)ncc1C#CCCCNC(=O)[C@@H]1C[C@H](O)CN1C(=O)C=CCN(C)C |
| InChI | InChI=1S/C30H42N8O5/c1-37(2)16-8-11-27(40)38-21-24(39)19-25(38)29(41)33-13-7-5-6-10-22-20-34-30(36-28(22)32-14-9-17-42-3)35-23-12-15-31-26(18-23)43-4/h8,11-12,15,18,20,24-25,39H,5,7,9,13-14,16-17,19,21H2,1-4H3,(H,33,41)(H2,31,32,34,35,36)/t24-,25-/m0/s1 |
| InChIKey | YAQPFMOZPROTKD-DQEYMECFSA-N |
| XLogP | 1.40 |
| TPSA | 154.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.72 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|