C34H45N9O5 — CID 123780617
ethyl 5-[[5-[5-[[(2S)-1-[4-(dimethylamino)but-2-enoyl]pyrrolidine-2-carbonyl]amino]pent-1-ynyl]-4-(propylamino)pyrimidin-2-yl]amino]-3-methoxyindazole-1-carboxylate (PubChem CID 123780617) has the molecular formula C34H45N9O5 and a molecular weight of 659.79 g/mol. Its IUPAC name is ethyl 5-[[5-[5-[[(2S)-1-[4-(dimethylamino)but-2-enoyl]pyrrolidine-2-carbonyl]amino]pent-1-ynyl]-4-(propylamino)pyrimidin-2-yl]amino]-3-methoxyindazole-1-carboxylate.
| Compound Name | ethyl 5-[[5-[5-[[(2S)-1-[4-(dimethylamino)but-2-enoyl]pyrrolidine-2-carbonyl]amino]pent-1-ynyl]-4-(propylamino)pyrimidin-2-yl]amino]-3-methoxyindazole-1-carboxylate |
|---|---|
| PubChem CID | 123780617 |
| Molecular Formula | C34H45N9O5 |
| Molecular Weight | 659.79 g/mol |
| Exact Mass | 659.35 |
| IUPAC Name | ethyl 5-[[5-[5-[[(2S)-1-[4-(dimethylamino)but-2-enoyl]pyrrolidine-2-carbonyl]amino]pent-1-ynyl]-4-(propylamino)pyrimidin-2-yl]amino]-3-methoxyindazole-1-carboxylate |
| SMILES | CCCNc1nc(Nc2ccc3c(c2)c(OC)nn3C(=O)OCC)ncc1C#CCCCNC(=O)[C@@H]1CCCN1C(=O)C=CCN(C)C |
| InChI | InChI=1S/C34H45N9O5/c1-6-18-35-30-24(13-9-8-10-19-36-31(45)28-14-11-21-42(28)29(44)15-12-20-41(3)4)23-37-33(39-30)38-25-16-17-27-26(22-25)32(47-5)40-43(27)34(46)48-7-2/h12,15-17,22-23,28H,6-8,10-11,14,18-21H2,1-5H3,(H,36,45)(H2,35,37,38,39)/t28-/m0/s1 |
| InChIKey | PDWVQRGUUXHADK-NDEPHWFRSA-N |
| XLogP | 3.76 |
| TPSA | 155.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.79 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|