C30H38N8O2 — CID 157473853
(2S)-1-[(E)-4-(dimethylamino)but-2-enoyl]-N-[5-[4-(ethylamino)-2-(1H-isoindol-5-ylamino)pyrimidin-5-yl]pent-4-ynyl]pyrrolidine-2-carboxamide (PubChem CID 157473853) has the molecular formula C30H38N8O2 and a molecular weight of 542.69 g/mol. Its IUPAC name is (2S)-1-[(E)-4-(dimethylamino)but-2-enoyl]-N-[5-[4-(ethylamino)-2-(1H-isoindol-5-ylamino)pyrimidin-5-yl]pent-4-ynyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(E)-4-(dimethylamino)but-2-enoyl]-N-[5-[4-(ethylamino)-2-(1H-isoindol-5-ylamino)pyrimidin-5-yl]pent-4-ynyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 157473853 |
| Molecular Formula | C30H38N8O2 |
| Molecular Weight | 542.69 g/mol |
| Exact Mass | 542.31 |
| IUPAC Name | (2S)-1-[(E)-4-(dimethylamino)but-2-enoyl]-N-[5-[4-(ethylamino)-2-(1H-isoindol-5-ylamino)pyrimidin-5-yl]pent-4-ynyl]pyrrolidine-2-carboxamide |
| SMILES | CCNc1nc(Nc2ccc3c(c2)C=NC3)ncc1C#CCCCNC(=O)[C@@H]1CCCN1C(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C30H38N8O2/c1-4-32-28-23(21-34-30(36-28)35-25-14-13-22-19-31-20-24(22)18-25)10-6-5-7-15-33-29(40)26-11-8-17-38(26)27(39)12-9-16-37(2)3/h9,12-14,18,20-21,26H,4-5,7-8,11,15-17,19H2,1-3H3,(H,33,40)(H2,32,34,35,36)/b12-9+/t26-/m0/s1 |
| InChIKey | BVISUYDHZNDMFU-UBWSOHEKSA-N |
| XLogP | 2.94 |
| TPSA | 114.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.69 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|