C31H42N8O4 — CID 90053164
tert-butyl (2S)-2-[5-[2-[(3-methoxy-1-methylindazol-6-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynylcarbamoyl]pyrrolidine-1-carboxylate (PubChem CID 90053164) has the molecular formula C31H42N8O4 and a molecular weight of 590.73 g/mol. Its IUPAC name is tert-butyl (2S)-2-[5-[2-[(3-methoxy-1-methylindazol-6-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynylcarbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[5-[2-[(3-methoxy-1-methylindazol-6-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynylcarbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 90053164 |
| Molecular Formula | C31H42N8O4 |
| Molecular Weight | 590.73 g/mol |
| Exact Mass | 590.33 |
| IUPAC Name | tert-butyl (2S)-2-[5-[2-[(3-methoxy-1-methylindazol-6-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynylcarbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CCCNc1nc(Nc2ccc3c(OC)nn(C)c3c2)ncc1C#CCCCNC(=O)[C@@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H42N8O4/c1-7-16-32-26-21(20-34-29(36-26)35-22-14-15-23-25(19-22)38(5)37-28(23)42-6)12-9-8-10-17-33-27(40)24-13-11-18-39(24)30(41)43-31(2,3)4/h14-15,19-20,24H,7-8,10-11,13,16-18H2,1-6H3,(H,33,40)(H2,32,34,35,36)/t24-/m0/s1 |
| InChIKey | BFBHJTYRPSVWTI-DEOSSOPVSA-N |
| XLogP | 4.58 |
| TPSA | 135.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.73 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|