C34H47N9O4 — CID 90052486
(2S)-1-[(E)-4-(dimethylamino)but-2-enoyl]-N-[5-[2-[[3-methoxy-1-(2-methoxyethyl)indazol-6-yl]amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]pyrrolidine-2-carboxamide (PubChem CID 90052486) has the molecular formula C34H47N9O4 and a molecular weight of 645.81 g/mol. Its IUPAC name is (2S)-1-[(E)-4-(dimethylamino)but-2-enoyl]-N-[5-[2-[[3-methoxy-1-(2-methoxyethyl)indazol-6-yl]amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(E)-4-(dimethylamino)but-2-enoyl]-N-[5-[2-[[3-methoxy-1-(2-methoxyethyl)indazol-6-yl]amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 90052486 |
| Molecular Formula | C34H47N9O4 |
| Molecular Weight | 645.81 g/mol |
| Exact Mass | 645.38 |
| IUPAC Name | (2S)-1-[(E)-4-(dimethylamino)but-2-enoyl]-N-[5-[2-[[3-methoxy-1-(2-methoxyethyl)indazol-6-yl]amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]pyrrolidine-2-carboxamide |
| SMILES | CCCNc1nc(Nc2ccc3c(OC)nn(CCOC)c3c2)ncc1C#CCCCNC(=O)[C@@H]1CCCN1C(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C34H47N9O4/c1-6-17-35-31-25(12-8-7-9-18-36-32(45)28-13-10-20-42(28)30(44)14-11-19-41(2)3)24-37-34(39-31)38-26-15-16-27-29(23-26)43(21-22-46-4)40-33(27)47-5/h11,14-16,23-24,28H,6-7,9-10,13,17-22H2,1-5H3,(H,36,45)(H2,35,37,38,39)/b14-11+/t28-/m0/s1 |
| InChIKey | APQCHLXUDAUKEF-IUKPUOCZSA-N |
| XLogP | 3.40 |
| TPSA | 138.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.81 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|