C28H35N9O2 — CID 90053232
(2S)-1-[(E)-4-(dimethylamino)but-2-enoyl]-N-[5-[2-(1H-indazol-5-ylamino)-4-(methylamino)pyrimidin-5-yl]pent-4-ynyl]pyrrolidine-2-carboxamide (PubChem CID 90053232) has the molecular formula C28H35N9O2 and a molecular weight of 529.65 g/mol. Its IUPAC name is (2S)-1-[(E)-4-(dimethylamino)but-2-enoyl]-N-[5-[2-(1H-indazol-5-ylamino)-4-(methylamino)pyrimidin-5-yl]pent-4-ynyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(E)-4-(dimethylamino)but-2-enoyl]-N-[5-[2-(1H-indazol-5-ylamino)-4-(methylamino)pyrimidin-5-yl]pent-4-ynyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 90053232 |
| Molecular Formula | C28H35N9O2 |
| Molecular Weight | 529.65 g/mol |
| Exact Mass | 529.29 |
| IUPAC Name | (2S)-1-[(E)-4-(dimethylamino)but-2-enoyl]-N-[5-[2-(1H-indazol-5-ylamino)-4-(methylamino)pyrimidin-5-yl]pent-4-ynyl]pyrrolidine-2-carboxamide |
| SMILES | CNc1nc(Nc2ccc3[nH]ncc3c2)ncc1C#CCCCNC(=O)[C@@H]1CCCN1C(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C28H35N9O2/c1-29-26-20(18-31-28(34-26)33-22-12-13-23-21(17-22)19-32-35-23)9-5-4-6-14-30-27(39)24-10-7-16-37(24)25(38)11-8-15-36(2)3/h8,11-13,17-19,24H,4,6-7,10,14-16H2,1-3H3,(H,30,39)(H,32,35)(H2,29,31,33,34)/b11-8+/t24-/m0/s1 |
| InChIKey | BUHCIXDGWKNQAF-DDVUFSRBSA-N |
| XLogP | 2.49 |
| TPSA | 131.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.65 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|