C27H34FN7O3 — CID 90052404
(2S,4S)-1-[(E)-4-(dimethylamino)but-2-enoyl]-N-[5-[2-(4-fluoroanilino)-4-(methylamino)pyrimidin-5-yl]pent-4-ynyl]-4-hydroxypyrrolidine-2-carboxamide (PubChem CID 90052404) has the molecular formula C27H34FN7O3 and a molecular weight of 523.61 g/mol. Its IUPAC name is (2S,4S)-1-[(E)-4-(dimethylamino)but-2-enoyl]-N-[5-[2-(4-fluoroanilino)-4-(methylamino)pyrimidin-5-yl]pent-4-ynyl]-4-hydroxypyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-1-[(E)-4-(dimethylamino)but-2-enoyl]-N-[5-[2-(4-fluoroanilino)-4-(methylamino)pyrimidin-5-yl]pent-4-ynyl]-4-hydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 90052404 |
| Molecular Formula | C27H34FN7O3 |
| Molecular Weight | 523.61 g/mol |
| Exact Mass | 523.27 |
| IUPAC Name | (2S,4S)-1-[(E)-4-(dimethylamino)but-2-enoyl]-N-[5-[2-(4-fluoroanilino)-4-(methylamino)pyrimidin-5-yl]pent-4-ynyl]-4-hydroxypyrrolidine-2-carboxamide |
| SMILES | CNc1nc(Nc2ccc(F)cc2)ncc1C#CCCCNC(=O)[C@@H]1C[C@H](O)CN1C(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C27H34FN7O3/c1-29-25-19(17-31-27(33-25)32-21-12-10-20(28)11-13-21)8-5-4-6-14-30-26(38)23-16-22(36)18-35(23)24(37)9-7-15-34(2)3/h7,9-13,17,22-23,36H,4,6,14-16,18H2,1-3H3,(H,30,38)(H2,29,31,32,33)/b9-7+/t22-,23-/m0/s1 |
| InChIKey | KYJJBOKXEYZXTO-DXVFKNEASA-N |
| XLogP | 1.73 |
| TPSA | 122.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.61 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|