C31H37FN8O3 — CID 123607883
4-(dimethylamino)-N-[(2S)-1-[5-[2-(3-fluoroanilino)-4-[(6-methoxy-3-pyridinyl)amino]pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-N-methylbut-2-enamide (PubChem CID 123607883) has the molecular formula C31H37FN8O3 and a molecular weight of 588.69 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[(2S)-1-[5-[2-(3-fluoroanilino)-4-[(6-methoxy-3-pyridinyl)amino]pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-N-methylbut-2-enamide.
| Compound Name | 4-(dimethylamino)-N-[(2S)-1-[5-[2-(3-fluoroanilino)-4-[(6-methoxy-3-pyridinyl)amino]pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-N-methylbut-2-enamide |
|---|---|
| PubChem CID | 123607883 |
| Molecular Formula | C31H37FN8O3 |
| Molecular Weight | 588.69 g/mol |
| Exact Mass | 588.30 |
| IUPAC Name | 4-(dimethylamino)-N-[(2S)-1-[5-[2-(3-fluoroanilino)-4-[(6-methoxy-3-pyridinyl)amino]pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-N-methylbut-2-enamide |
| SMILES | COc1ccc(Nc2nc(Nc3cccc(F)c3)ncc2C#CCCCNC(=O)[C@H](C)N(C)C(=O)C=CCN(C)C)cn1 |
| InChI | InChI=1S/C31H37FN8O3/c1-22(40(4)28(41)14-10-18-39(2)3)30(42)33-17-8-6-7-11-23-20-35-31(37-25-13-9-12-24(32)19-25)38-29(23)36-26-15-16-27(43-5)34-21-26/h9-10,12-16,19-22H,6,8,17-18H2,1-5H3,(H,33,42)(H2,35,36,37,38)/t22-/m0/s1 |
| InChIKey | IJZLCORQDKEGJB-QFIPXVFZSA-N |
| XLogP | 3.72 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.69 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|