C29H42N8O4 — CID 123490766
4-(dimethylamino)-N-[(2S)-1-[5-[4-(3-methoxypropylamino)-2-[(2-methoxy-4-pyridinyl)amino]pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-N-methylbut-2-enamide (PubChem CID 123490766) has the molecular formula C29H42N8O4 and a molecular weight of 566.71 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[(2S)-1-[5-[4-(3-methoxypropylamino)-2-[(2-methoxy-4-pyridinyl)amino]pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-N-methylbut-2-enamide.
| Compound Name | 4-(dimethylamino)-N-[(2S)-1-[5-[4-(3-methoxypropylamino)-2-[(2-methoxy-4-pyridinyl)amino]pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-N-methylbut-2-enamide |
|---|---|
| PubChem CID | 123490766 |
| Molecular Formula | C29H42N8O4 |
| Molecular Weight | 566.71 g/mol |
| Exact Mass | 566.33 |
| IUPAC Name | 4-(dimethylamino)-N-[(2S)-1-[5-[4-(3-methoxypropylamino)-2-[(2-methoxy-4-pyridinyl)amino]pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-N-methylbut-2-enamide |
| SMILES | COCCCNc1nc(Nc2ccnc(OC)c2)ncc1C#CCCCNC(=O)[C@H](C)N(C)C(=O)C=CCN(C)C |
| InChI | InChI=1S/C29H42N8O4/c1-22(37(4)26(38)13-10-18-36(2)3)28(39)32-15-9-7-8-12-23-21-33-29(35-27(23)31-16-11-19-40-5)34-24-14-17-30-25(20-24)41-6/h10,13-14,17,20-22H,7,9,11,15-16,18-19H2,1-6H3,(H,32,39)(H2,30,31,33,34,35)/t22-/m0/s1 |
| InChIKey | FKZCITIZALLMOU-QFIPXVFZSA-N |
| XLogP | 2.28 |
| TPSA | 133.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.71 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|