C29H38F3N7O3 — CID 123206520
4-(dimethylamino)-N-methyl-N-[(2S)-1-oxo-1-[5-[4-(propylamino)-2-[3-(trifluoromethoxy)anilino]pyrimidin-5-yl]pent-4-ynylamino]propan-2-yl]but-2-enamide (PubChem CID 123206520) has the molecular formula C29H38F3N7O3 and a molecular weight of 589.66 g/mol. Its IUPAC name is 4-(dimethylamino)-N-methyl-N-[(2S)-1-oxo-1-[5-[4-(propylamino)-2-[3-(trifluoromethoxy)anilino]pyrimidin-5-yl]pent-4-ynylamino]propan-2-yl]but-2-enamide.
| Compound Name | 4-(dimethylamino)-N-methyl-N-[(2S)-1-oxo-1-[5-[4-(propylamino)-2-[3-(trifluoromethoxy)anilino]pyrimidin-5-yl]pent-4-ynylamino]propan-2-yl]but-2-enamide |
|---|---|
| PubChem CID | 123206520 |
| Molecular Formula | C29H38F3N7O3 |
| Molecular Weight | 589.66 g/mol |
| Exact Mass | 589.30 |
| IUPAC Name | 4-(dimethylamino)-N-methyl-N-[(2S)-1-oxo-1-[5-[4-(propylamino)-2-[3-(trifluoromethoxy)anilino]pyrimidin-5-yl]pent-4-ynylamino]propan-2-yl]but-2-enamide |
| SMILES | CCCNc1nc(Nc2cccc(OC(F)(F)F)c2)ncc1C#CCCCNC(=O)[C@H](C)N(C)C(=O)C=CCN(C)C |
| InChI | InChI=1S/C29H38F3N7O3/c1-6-16-33-26-22(20-35-28(37-26)36-23-13-10-14-24(19-23)42-29(30,31)32)12-8-7-9-17-34-27(41)21(2)39(5)25(40)15-11-18-38(3)4/h10-11,13-15,19-21H,6-7,9,16-18H2,1-5H3,(H,34,41)(H2,33,35,36,37)/t21-/m0/s1 |
| InChIKey | DNMNCWLYGNQRAQ-NRFANRHFSA-N |
| XLogP | 4.15 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.66 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|