C32H43N9O4 — CID 90052916
ethyl 4-[[5-[5-[[(2S)-2-[[(E)-4-(dimethylamino)but-2-enoyl]-methylamino]propanoyl]amino]pent-1-ynyl]-4-(propylamino)pyrimidin-2-yl]amino]indazole-1-carboxylate (PubChem CID 90052916) has the molecular formula C32H43N9O4 and a molecular weight of 617.76 g/mol. Its IUPAC name is ethyl 4-[[5-[5-[[(2S)-2-[[(E)-4-(dimethylamino)but-2-enoyl]-methylamino]propanoyl]amino]pent-1-ynyl]-4-(propylamino)pyrimidin-2-yl]amino]indazole-1-carboxylate.
| Compound Name | ethyl 4-[[5-[5-[[(2S)-2-[[(E)-4-(dimethylamino)but-2-enoyl]-methylamino]propanoyl]amino]pent-1-ynyl]-4-(propylamino)pyrimidin-2-yl]amino]indazole-1-carboxylate |
|---|---|
| PubChem CID | 90052916 |
| Molecular Formula | C32H43N9O4 |
| Molecular Weight | 617.76 g/mol |
| Exact Mass | 617.34 |
| IUPAC Name | ethyl 4-[[5-[5-[[(2S)-2-[[(E)-4-(dimethylamino)but-2-enoyl]-methylamino]propanoyl]amino]pent-1-ynyl]-4-(propylamino)pyrimidin-2-yl]amino]indazole-1-carboxylate |
| SMILES | CCCNc1nc(Nc2cccc3c2cnn3C(=O)OCC)ncc1C#CCCCNC(=O)[C@H](C)N(C)C(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C32H43N9O4/c1-7-18-33-29-24(14-10-9-11-19-34-30(43)23(3)40(6)28(42)17-13-20-39(4)5)21-35-31(38-29)37-26-15-12-16-27-25(26)22-36-41(27)32(44)45-8-2/h12-13,15-17,21-23H,7-9,11,18-20H2,1-6H3,(H,34,43)(H2,33,35,37,38)/b17-13+/t23-/m0/s1 |
| InChIKey | OJAHCBGVNFEBOY-ILAWTMEDSA-N |
| XLogP | 3.61 |
| TPSA | 146.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.76 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|