C29H38N8O3 — CID 90053499
(E)-N-[(2S)-1-[5-[2-(4-cyanoanilino)-4-(2-methoxyethylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-4-(dimethylamino)-N-methylbut-2-enamide (PubChem CID 90053499) has the molecular formula C29H38N8O3 and a molecular weight of 546.68 g/mol. Its IUPAC name is (E)-N-[(2S)-1-[5-[2-(4-cyanoanilino)-4-(2-methoxyethylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-4-(dimethylamino)-N-methylbut-2-enamide.
| Compound Name | (E)-N-[(2S)-1-[5-[2-(4-cyanoanilino)-4-(2-methoxyethylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-4-(dimethylamino)-N-methylbut-2-enamide |
|---|---|
| PubChem CID | 90053499 |
| Molecular Formula | C29H38N8O3 |
| Molecular Weight | 546.68 g/mol |
| Exact Mass | 546.31 |
| IUPAC Name | (E)-N-[(2S)-1-[5-[2-(4-cyanoanilino)-4-(2-methoxyethylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-4-(dimethylamino)-N-methylbut-2-enamide |
| SMILES | COCCNc1nc(Nc2ccc(C#N)cc2)ncc1C#CCCCNC(=O)[C@H](C)N(C)C(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C29H38N8O3/c1-22(37(4)26(38)11-9-18-36(2)3)28(39)32-16-8-6-7-10-24-21-33-29(35-27(24)31-17-19-40-5)34-25-14-12-23(20-30)13-15-25/h9,11-15,21-22H,6,8,16-19H2,1-5H3,(H,32,39)(H2,31,33,34,35)/b11-9+/t22-/m0/s1 |
| InChIKey | CZZZTFLCICPPGI-CRWWQRIJSA-N |
| XLogP | 2.36 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.68 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|