C30H38N8O2 — CID 90051776
(E)-N-[(2S)-1-[5-[2-(4-cyanoanilino)-4-pyrrolidin-1-ylpyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-4-(dimethylamino)-N-methylbut-2-enamide (PubChem CID 90051776) has the molecular formula C30H38N8O2 and a molecular weight of 542.69 g/mol. Its IUPAC name is (E)-N-[(2S)-1-[5-[2-(4-cyanoanilino)-4-pyrrolidin-1-ylpyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-4-(dimethylamino)-N-methylbut-2-enamide.
| Compound Name | (E)-N-[(2S)-1-[5-[2-(4-cyanoanilino)-4-pyrrolidin-1-ylpyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-4-(dimethylamino)-N-methylbut-2-enamide |
|---|---|
| PubChem CID | 90051776 |
| Molecular Formula | C30H38N8O2 |
| Molecular Weight | 542.69 g/mol |
| Exact Mass | 542.31 |
| IUPAC Name | (E)-N-[(2S)-1-[5-[2-(4-cyanoanilino)-4-pyrrolidin-1-ylpyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-4-(dimethylamino)-N-methylbut-2-enamide |
| SMILES | C[C@@H](C(=O)NCCCC#Cc1cnc(Nc2ccc(C#N)cc2)nc1N1CCCC1)N(C)C(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C30H38N8O2/c1-23(37(4)27(39)12-10-18-36(2)3)29(40)32-17-7-5-6-11-25-22-33-30(35-28(25)38-19-8-9-20-38)34-26-15-13-24(21-31)14-16-26/h10,12-16,22-23H,5,7-9,17-20H2,1-4H3,(H,32,40)(H,33,34,35)/b12-10+/t23-/m0/s1 |
| InChIKey | DAPHUMJSDYXDKS-XDQZKXAQSA-N |
| XLogP | 2.90 |
| TPSA | 117.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.69 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|