C30H39N9O2 — CID 90053536
(E)-4-(dimethylamino)-N-methyl-N-[(2S)-1-oxo-1-[5-[4-(propylamino)-2-(quinoxalin-6-ylamino)pyrimidin-5-yl]pent-4-ynylamino]propan-2-yl]but-2-enamide (PubChem CID 90053536) has the molecular formula C30H39N9O2 and a molecular weight of 557.70 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-N-methyl-N-[(2S)-1-oxo-1-[5-[4-(propylamino)-2-(quinoxalin-6-ylamino)pyrimidin-5-yl]pent-4-ynylamino]propan-2-yl]but-2-enamide.
| Compound Name | (E)-4-(dimethylamino)-N-methyl-N-[(2S)-1-oxo-1-[5-[4-(propylamino)-2-(quinoxalin-6-ylamino)pyrimidin-5-yl]pent-4-ynylamino]propan-2-yl]but-2-enamide |
|---|---|
| PubChem CID | 90053536 |
| Molecular Formula | C30H39N9O2 |
| Molecular Weight | 557.70 g/mol |
| Exact Mass | 557.32 |
| IUPAC Name | (E)-4-(dimethylamino)-N-methyl-N-[(2S)-1-oxo-1-[5-[4-(propylamino)-2-(quinoxalin-6-ylamino)pyrimidin-5-yl]pent-4-ynylamino]propan-2-yl]but-2-enamide |
| SMILES | CCCNc1nc(Nc2ccc3nccnc3c2)ncc1C#CCCCNC(=O)[C@H](C)N(C)C(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C30H39N9O2/c1-6-15-33-28-23(21-35-30(37-28)36-24-13-14-25-26(20-24)32-18-17-31-25)11-8-7-9-16-34-29(41)22(2)39(5)27(40)12-10-19-38(3)4/h10,12-14,17-18,20-22H,6-7,9,15-16,19H2,1-5H3,(H,34,41)(H2,33,35,36,37)/b12-10+/t22-/m0/s1 |
| InChIKey | GRRFTCLKLBQJLA-YUAYGMJFSA-N |
| XLogP | 3.20 |
| TPSA | 128.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.70 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|